C29H14N4O3 — CID 2170646
4-[4-[4-(3,4-dicyanophenoxy)benzoyl]phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 2170646) has the molecular formula C29H14N4O3 and a molecular weight of 466.46 g/mol. Its IUPAC name is 4-[4-[4-(3,4-dicyanophenoxy)benzoyl]phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-[4-(3,4-dicyanophenoxy)benzoyl]phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 2170646 |
| Molecular Formula | C29H14N4O3 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 4-[4-[4-(3,4-dicyanophenoxy)benzoyl]phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(C(=O)c3ccc(Oc4ccc(C#N)c(C#N)c4)cc3)cc2)cc1C#N |
| InChI | InChI=1S/C29H14N4O3/c30-15-21-5-11-27(13-23(21)17-32)35-25-7-1-19(2-8-25)29(34)20-3-9-26(10-4-20)36-28-12-6-22(16-31)24(14-28)18-33/h1-14H |
| InChIKey | BVNNROQJDXAFOS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 130.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |