C23H14N2O4 — CID 3876519
[2-[4-(3,4-dicyanophenoxy)phenyl]-2-oxoethyl] benzoate (PubChem CID 3876519) has the molecular formula C23H14N2O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is [2-[4-(3,4-dicyanophenoxy)phenyl]-2-oxoethyl] benzoate.
| Compound Name | [2-[4-(3,4-dicyanophenoxy)phenyl]-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 3876519 |
| Molecular Formula | C23H14N2O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [2-[4-(3,4-dicyanophenoxy)phenyl]-2-oxoethyl] benzoate |
| SMILES | N#Cc1ccc(Oc2ccc(C(=O)COC(=O)c3ccccc3)cc2)cc1C#N |
| InChI | InChI=1S/C23H14N2O4/c24-13-18-8-11-21(12-19(18)14-25)29-20-9-6-16(7-10-20)22(26)15-28-23(27)17-4-2-1-3-5-17/h1-12H,15H2 |
| InChIKey | WTXJCEUWQLVDLO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |