C16H11N3O2 — CID 118858046
2-[4-(3,4-dicyanophenoxy)phenyl]acetamide (PubChem CID 118858046) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[4-(3,4-dicyanophenoxy)phenyl]acetamide.
| Compound Name | 2-[4-(3,4-dicyanophenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 118858046 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-[4-(3,4-dicyanophenoxy)phenyl]acetamide |
| SMILES | N#Cc1ccc(Oc2ccc(CC(N)=O)cc2)cc1C#N |
| InChI | InChI=1S/C16H11N3O2/c17-9-12-3-6-15(8-13(12)10-18)21-14-4-1-11(2-5-14)7-16(19)20/h1-6,8H,7H2,(H2,19,20) |
| InChIKey | WINCIZYSKWIULL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |