C36H20N6O4 — CID 10886540
4-(3,4-dicyanophenoxy)-N-[4-[[4-(3,4-dicyanophenoxy)benzoyl]amino]phenyl]benzamide (PubChem CID 10886540) has the molecular formula C36H20N6O4 and a molecular weight of 600.59 g/mol. Its IUPAC name is 4-(3,4-dicyanophenoxy)-N-[4-[[4-(3,4-dicyanophenoxy)benzoyl]amino]phenyl]benzamide.
| Compound Name | 4-(3,4-dicyanophenoxy)-N-[4-[[4-(3,4-dicyanophenoxy)benzoyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 10886540 |
| Molecular Formula | C36H20N6O4 |
| Molecular Weight | 600.59 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 4-(3,4-dicyanophenoxy)-N-[4-[[4-(3,4-dicyanophenoxy)benzoyl]amino]phenyl]benzamide |
| SMILES | N#Cc1ccc(Oc2ccc(C(=O)Nc3ccc(NC(=O)c4ccc(Oc5ccc(C#N)c(C#N)c5)cc4)cc3)cc2)cc1C#N |
| InChI | InChI=1S/C36H20N6O4/c37-19-25-5-15-33(17-27(25)21-39)45-31-11-1-23(2-12-31)35(43)41-29-7-9-30(10-8-29)42-36(44)24-3-13-32(14-4-24)46-34-16-6-26(20-38)28(18-34)22-40/h1-18H,(H,41,43)(H,42,44) |
| InChIKey | XRCXLIGBQDLSJS-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 171.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.59 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |