C36H28N4O2 — CID 102136754
N-[4-(3,4-dicyanophenoxy)phenyl]-2-(tritylamino)propanamide (PubChem CID 102136754) has the molecular formula C36H28N4O2 and a molecular weight of 548.65 g/mol. Its IUPAC name is N-[4-(3,4-dicyanophenoxy)phenyl]-2-(tritylamino)propanamide.
| Compound Name | N-[4-(3,4-dicyanophenoxy)phenyl]-2-(tritylamino)propanamide |
|---|---|
| PubChem CID | 102136754 |
| Molecular Formula | C36H28N4O2 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | N-[4-(3,4-dicyanophenoxy)phenyl]-2-(tritylamino)propanamide |
| SMILES | CC(NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)Nc1ccc(Oc2ccc(C#N)c(C#N)c2)cc1 |
| InChI | InChI=1S/C36H28N4O2/c1-26(35(41)39-32-18-21-33(22-19-32)42-34-20-17-27(24-37)28(23-34)25-38)40-36(29-11-5-2-6-12-29,30-13-7-3-8-14-30)31-15-9-4-10-16-31/h2-23,26,40H,1H3,(H,39,41) |
| InChIKey | QYJDGPMRQDQIDT-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|