C26H16N2O3 — CID 15667751
4-(3,5-diphenoxyphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 15667751) has the molecular formula C26H16N2O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-(3,5-diphenoxyphenoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(3,5-diphenoxyphenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 15667751 |
| Molecular Formula | C26H16N2O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 4-(3,5-diphenoxyphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2cc(Oc3ccccc3)cc(Oc3ccccc3)c2)cc1C#N |
| InChI | InChI=1S/C26H16N2O3/c27-17-19-11-12-23(13-20(19)18-28)31-26-15-24(29-21-7-3-1-4-8-21)14-25(16-26)30-22-9-5-2-6-10-22/h1-16H |
| InChIKey | VSQKTUAWIBNIJF-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |