C21H14N2O2 — CID 21297486
4-[3-[hydroxy(phenyl)methyl]phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 21297486) has the molecular formula C21H14N2O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 4-[3-[hydroxy(phenyl)methyl]phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[3-[hydroxy(phenyl)methyl]phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 21297486 |
| Molecular Formula | C21H14N2O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-[3-[hydroxy(phenyl)methyl]phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2cccc(C(O)c3ccccc3)c2)cc1C#N |
| InChI | InChI=1S/C21H14N2O2/c22-13-17-9-10-20(12-18(17)14-23)25-19-8-4-7-16(11-19)21(24)15-5-2-1-3-6-15/h1-12,21,24H |
| InChIKey | ANJIOFZCUDZBLD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |