C29H18N2O4 — CID 2221409
(3-benzoylphenyl)methyl 4-(3,4-dicyanophenoxy)benzoate (PubChem CID 2221409) has the molecular formula C29H18N2O4 and a molecular weight of 458.47 g/mol. Its IUPAC name is (3-benzoylphenyl)methyl 4-(3,4-dicyanophenoxy)benzoate.
| Compound Name | (3-benzoylphenyl)methyl 4-(3,4-dicyanophenoxy)benzoate |
|---|---|
| PubChem CID | 2221409 |
| Molecular Formula | C29H18N2O4 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | (3-benzoylphenyl)methyl 4-(3,4-dicyanophenoxy)benzoate |
| SMILES | N#Cc1ccc(Oc2ccc(C(=O)OCc3cccc(C(=O)c4ccccc4)c3)cc2)cc1C#N |
| InChI | InChI=1S/C29H18N2O4/c30-17-24-11-14-27(16-25(24)18-31)35-26-12-9-22(10-13-26)29(33)34-19-20-5-4-8-23(15-20)28(32)21-6-2-1-3-7-21/h1-16H,19H2 |
| InChIKey | ZIFCAWSNPMYTLH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |