C29H16N4O — CID 158070713
4-[4-[4-[(3,4-diisocyanophenyl)methyl]phenyl]phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 158070713) has the molecular formula C29H16N4O and a molecular weight of 436.47 g/mol. Its IUPAC name is 4-[4-[4-[(3,4-diisocyanophenyl)methyl]phenyl]phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-[4-[(3,4-diisocyanophenyl)methyl]phenyl]phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 158070713 |
| Molecular Formula | C29H16N4O |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 4-[4-[4-[(3,4-diisocyanophenyl)methyl]phenyl]phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | [C-]#[N+]c1ccc(Cc2ccc(-c3ccc(Oc4ccc(C#N)c(C#N)c4)cc3)cc2)cc1[N+]#[C-] |
| InChI | InChI=1S/C29H16N4O/c1-32-28-14-5-21(16-29(28)33-2)15-20-3-6-22(7-4-20)23-8-11-26(12-9-23)34-27-13-10-24(18-30)25(17-27)19-31/h3-14,16-17H,15H2 |
| InChIKey | QUEWELOUBOZLPU-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 65.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|