C25H21NO — CID 157139484
2-ethynyl-5-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzonitrile (PubChem CID 157139484) has the molecular formula C25H21NO and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-ethynyl-5-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzonitrile.
| Compound Name | 2-ethynyl-5-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 157139484 |
| Molecular Formula | C25H21NO |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-ethynyl-5-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzonitrile |
| SMILES | C#Cc1ccc(Oc2ccc(C(C)(C)c3ccc(C)cc3)cc2)cc1C#N |
| InChI | InChI=1S/C25H21NO/c1-5-19-8-13-24(16-20(19)17-26)27-23-14-11-22(12-15-23)25(3,4)21-9-6-18(2)7-10-21/h1,6-16H,2-4H3 |
| InChIKey | ZVOMKYYRLLGGGP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|