C30H20F2N4Pt+2 — CID 58568693
CID 58568693 (PubChem CID 58568693) has the molecular formula C30H20F2N4Pt+2 and a molecular weight of 669.59 g/mol.
| Compound Name | CID 58568693 |
|---|---|
| PubChem CID | 58568693 |
| Molecular Formula | C30H20F2N4Pt+2 |
| Molecular Weight | 669.59 g/mol |
| Exact Mass | 669.13 |
| IUPAC Name | — |
| SMILES | [C-]#[N+]c1cc2[c-]c(c1F)CN(C)c1ccccc1-c1[c-]c(c(F)c(C#N)c1)CN(C)c1ccccc1-2.[Pt+4] |
| InChI | InChI=1S/C30H20F2N4.Pt/c1-34-26-15-20-14-23(30(26)32)18-36(3)27-10-6-4-8-24(27)19-12-21(16-33)29(31)22(13-19)17-35(2)28-11-7-5-9-25(20)28;/h4-12,15H,17-18H2,2-3H3;/q-2;+4 |
| InChIKey | DONCNLKXMXZPFL-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.59 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|