C19H19N3 — CID 159852662
1,2-diisocyanobenzene;2-methylbenzonitrile;propane (PubChem CID 159852662) has the molecular formula C19H19N3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1,2-diisocyanobenzene;2-methylbenzonitrile;propane.
| Compound Name | 1,2-diisocyanobenzene;2-methylbenzonitrile;propane |
|---|---|
| PubChem CID | 159852662 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1,2-diisocyanobenzene;2-methylbenzonitrile;propane |
| SMILES | CCC.Cc1ccccc1C#N.[C-]#[N+]c1ccccc1[N+]#[C-] |
| InChI | InChI=1S/C8H4N2.C8H7N.C3H8/c1-9-7-5-3-4-6-8(7)10-2;1-7-4-2-3-5-8(7)6-9;1-3-2/h3-6H;2-5H,1H3;3H2,1-2H3 |
| InChIKey | NQDFMBLVZIGGLC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|