About azane;2-methylbenzonitrile
azane;2-methylbenzonitrile (PubChem CID 158673628) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is azane;2-methylbenzonitrile.
Molecular Properties
| Compound Name | azane;2-methylbenzonitrile |
| PubChem CID | 158673628 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | azane;2-methylbenzonitrile |
| SMILES | Cc1ccccc1C#N.N |
| InChI | InChI=1S/C8H7N.H3N/c1-7-4-2-3-5-8(7)6-9;/h2-5H,1H3;1H3 |
| InChIKey | IEGAQUXJGNRJEA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;2-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methylbenzonitrile?
The IUPAC name of azane;2-methylbenzonitrile (CID 158673628) is azane;2-methylbenzonitrile.
What is the SMILES notation for azane;2-methylbenzonitrile?
The canonical SMILES for azane;2-methylbenzonitrile is Cc1ccccc1C#N.N.
What is the InChIKey of azane;2-methylbenzonitrile?
The InChIKey is IEGAQUXJGNRJEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.H3N/c1-7-4-2-3-5-8(7)6-9;/h2-5H,1H3;1H3.
What are the key properties of azane;2-methylbenzonitrile?
azane;2-methylbenzonitrile has a molecular weight of 134.18 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methylbenzonitrile is sourced from PubChem (CID 158673628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).