About benzene-1,2-dicarbonitrile;palladium(2+);dichloride
benzene-1,2-dicarbonitrile;palladium(2+);dichloride (PubChem CID 175388598) has the molecular formula C8H4Cl2N2Pd
and a molecular weight of 305.46 g/mol. Its IUPAC name is benzene-1,2-dicarbonitrile;palladium(2+);dichloride.
Molecular Properties
| Compound Name | benzene-1,2-dicarbonitrile;palladium(2+);dichloride |
| PubChem CID | 175388598 |
| Molecular Formula | C8H4Cl2N2Pd |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 303.88 |
| IUPAC Name | benzene-1,2-dicarbonitrile;palladium(2+);dichloride |
| SMILES | N#Cc1ccccc1C#N.[Cl-].[Cl-].[Pd+2] |
| InChI | InChI=1S/C8H4N2.2ClH.Pd/c9-5-7-3-1-2-4-8(7)6-10;;;/h1-4H;2*1H;/q;;;+2/p-2 |
| InChIKey | YRTNKTMDJIPKIY-UHFFFAOYSA-L |
| XLogP | -4.56 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene-1,2-dicarbonitrile;palladium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-dicarbonitrile;palladium(2+);dichloride?
The IUPAC name of benzene-1,2-dicarbonitrile;palladium(2+);dichloride (CID 175388598) is benzene-1,2-dicarbonitrile;palladium(2+);dichloride.
What is the SMILES notation for benzene-1,2-dicarbonitrile;palladium(2+);dichloride?
The canonical SMILES for benzene-1,2-dicarbonitrile;palladium(2+);dichloride is N#Cc1ccccc1C#N.[Cl-].[Cl-].[Pd+2].
What is the InChIKey of benzene-1,2-dicarbonitrile;palladium(2+);dichloride?
The InChIKey is YRTNKTMDJIPKIY-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H4N2.2ClH.Pd/c9-5-7-3-1-2-4-8(7)6-10;;;/h1-4H;2*1H;/q;;;+2/p-2.
What are the key properties of benzene-1,2-dicarbonitrile;palladium(2+);dichloride?
benzene-1,2-dicarbonitrile;palladium(2+);dichloride has a molecular weight of 305.46 g/mol, XLogP of -4.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-dicarbonitrile;palladium(2+);dichloride is sourced from PubChem (CID 175388598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).