About 2-ethynylbenzonitrile
2-ethynylbenzonitrile (PubChem CID 11116074) has the molecular formula C9H5N
and a molecular weight of 127.15 g/mol. Its IUPAC name is 2-ethynylbenzonitrile.
Molecular Properties
| Compound Name | 2-ethynylbenzonitrile |
| PubChem CID | 11116074 |
| Molecular Formula | C9H5N |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 2-ethynylbenzonitrile |
| SMILES | C#Cc1ccccc1C#N |
| InChI | InChI=1S/C9H5N/c1-2-8-5-3-4-6-9(8)7-10/h1,3-6H |
| InChIKey | LZSDQLUEGYXDCW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynylbenzonitrile?
The IUPAC name of 2-ethynylbenzonitrile (CID 11116074) is 2-ethynylbenzonitrile.
What is the SMILES notation for 2-ethynylbenzonitrile?
The canonical SMILES for 2-ethynylbenzonitrile is C#Cc1ccccc1C#N.
What is the InChIKey of 2-ethynylbenzonitrile?
The InChIKey is LZSDQLUEGYXDCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N/c1-2-8-5-3-4-6-9(8)7-10/h1,3-6H.
What are the key properties of 2-ethynylbenzonitrile?
2-ethynylbenzonitrile has a molecular weight of 127.15 g/mol, XLogP of 1.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynylbenzonitrile is sourced from PubChem (CID 11116074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).