C22H10 — CID 12023743
1,2,4-triethynyl-5-[2-(2-ethynylphenyl)ethynyl]benzene (PubChem CID 12023743) has the molecular formula C22H10 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1,2,4-triethynyl-5-[2-(2-ethynylphenyl)ethynyl]benzene.
| Compound Name | 1,2,4-triethynyl-5-[2-(2-ethynylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 12023743 |
| Molecular Formula | C22H10 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1,2,4-triethynyl-5-[2-(2-ethynylphenyl)ethynyl]benzene |
| SMILES | C#Cc1ccccc1C#Cc1cc(C#C)c(C#C)cc1C#C |
| InChI | InChI=1S/C22H10/c1-5-17-11-9-10-12-21(17)13-14-22-16-19(7-3)18(6-2)15-20(22)8-4/h1-4,9-12,15-16H |
| InChIKey | GQSZTUNTHIWFLO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|