C18H14 — CID 11138964
1-[2-(2-ethynylphenyl)ethynyl]-3,5-dimethylbenzene (PubChem CID 11138964) has the molecular formula C18H14 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-[2-(2-ethynylphenyl)ethynyl]-3,5-dimethylbenzene.
| Compound Name | 1-[2-(2-ethynylphenyl)ethynyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 11138964 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 1-[2-(2-ethynylphenyl)ethynyl]-3,5-dimethylbenzene |
| SMILES | C#Cc1ccccc1C#Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H14/c1-4-17-7-5-6-8-18(17)10-9-16-12-14(2)11-15(3)13-16/h1,5-8,11-13H,2-3H3 |
| InChIKey | KWNMWEUHKBBUBV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|