C17H17N — CID 176780213
N-[3-(3,5-dimethylphenyl)prop-2-ynyl]aniline (PubChem CID 176780213) has the molecular formula C17H17N and a molecular weight of 235.33 g/mol. Its IUPAC name is N-[3-(3,5-dimethylphenyl)prop-2-ynyl]aniline.
| Compound Name | N-[3-(3,5-dimethylphenyl)prop-2-ynyl]aniline |
|---|---|
| PubChem CID | 176780213 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-[3-(3,5-dimethylphenyl)prop-2-ynyl]aniline |
| SMILES | Cc1cc(C)cc(C#CCNc2ccccc2)c1 |
| InChI | InChI=1S/C17H17N/c1-14-11-15(2)13-16(12-14)7-6-10-18-17-8-4-3-5-9-17/h3-5,8-9,11-13,18H,10H2,1-2H3 |
| InChIKey | OZDDLAFJVFSHML-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|