C16H13Cl2N — CID 104726759
2,5-dichloro-4-methyl-N-(3-phenylprop-2-ynyl)aniline (PubChem CID 104726759) has the molecular formula C16H13Cl2N and a molecular weight of 290.19 g/mol. Its IUPAC name is 2,5-dichloro-4-methyl-N-(3-phenylprop-2-ynyl)aniline.
| Compound Name | 2,5-dichloro-4-methyl-N-(3-phenylprop-2-ynyl)aniline |
|---|---|
| PubChem CID | 104726759 |
| Molecular Formula | C16H13Cl2N |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2,5-dichloro-4-methyl-N-(3-phenylprop-2-ynyl)aniline |
| SMILES | Cc1cc(Cl)c(NCC#Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C16H13Cl2N/c1-12-10-15(18)16(11-14(12)17)19-9-5-8-13-6-3-2-4-7-13/h2-4,6-7,10-11,19H,9H2,1H3 |
| InChIKey | ZCIPLNFJTCREGX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|