C15H11Br2N — CID 63492916
2,5-dibromo-N-(3-phenylprop-2-ynyl)aniline (PubChem CID 63492916) has the molecular formula C15H11Br2N and a molecular weight of 365.07 g/mol. Its IUPAC name is 2,5-dibromo-N-(3-phenylprop-2-ynyl)aniline.
| Compound Name | 2,5-dibromo-N-(3-phenylprop-2-ynyl)aniline |
|---|---|
| PubChem CID | 63492916 |
| Molecular Formula | C15H11Br2N |
| Molecular Weight | 365.07 g/mol |
| Exact Mass | 362.93 |
| IUPAC Name | 2,5-dibromo-N-(3-phenylprop-2-ynyl)aniline |
| SMILES | Brc1ccc(Br)c(NCC#Cc2ccccc2)c1 |
| InChI | InChI=1S/C15H11Br2N/c16-13-8-9-14(17)15(11-13)18-10-4-7-12-5-2-1-3-6-12/h1-3,5-6,8-9,11,18H,10H2 |
| InChIKey | KYCGVAVIJGWJAA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.07 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|