C17H16BrN — CID 81360187
N-[(1R)-1-(4-bromophenyl)ethyl]-3-phenylprop-2-yn-1-amine (PubChem CID 81360187) has the molecular formula C17H16BrN and a molecular weight of 314.23 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenyl)ethyl]-3-phenylprop-2-yn-1-amine.
| Compound Name | N-[(1R)-1-(4-bromophenyl)ethyl]-3-phenylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 81360187 |
| Molecular Formula | C17H16BrN |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-[(1R)-1-(4-bromophenyl)ethyl]-3-phenylprop-2-yn-1-amine |
| SMILES | C[C@@H](NCC#Cc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrN/c1-14(16-9-11-17(18)12-10-16)19-13-5-8-15-6-3-2-4-7-15/h2-4,6-7,9-12,14,19H,13H2,1H3/t14-/m1/s1 |
| InChIKey | XLFIMIAKEMMBSS-CQSZACIVSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|