C18H19N — CID 81361410
N-[(1S)-1-(3-methylphenyl)ethyl]-3-phenylprop-2-yn-1-amine (PubChem CID 81361410) has the molecular formula C18H19N and a molecular weight of 249.36 g/mol. Its IUPAC name is N-[(1S)-1-(3-methylphenyl)ethyl]-3-phenylprop-2-yn-1-amine.
| Compound Name | N-[(1S)-1-(3-methylphenyl)ethyl]-3-phenylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 81361410 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-[(1S)-1-(3-methylphenyl)ethyl]-3-phenylprop-2-yn-1-amine |
| SMILES | Cc1cccc([C@H](C)NCC#Cc2ccccc2)c1 |
| InChI | InChI=1S/C18H19N/c1-15-8-6-12-18(14-15)16(2)19-13-7-11-17-9-4-3-5-10-17/h3-6,8-10,12,14,16,19H,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | SLFBTHWBXQHMMK-INIZCTEOSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|