C18H17NO2 — CID 166224102
N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-phenylprop-2-yn-1-amine (PubChem CID 166224102) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-phenylprop-2-yn-1-amine.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-phenylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 166224102 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-3-phenylprop-2-yn-1-amine |
| SMILES | CC(NCC#Cc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H17NO2/c1-14(16-9-10-17-18(12-16)21-13-20-17)19-11-5-8-15-6-3-2-4-7-15/h2-4,6-7,9-10,12,14,19H,11,13H2,1H3 |
| InChIKey | KGMPYNDHDPKONM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|