C14H13Br2NS — CID 79222849
2,5-dibromo-N-(2-phenylsulfanylethyl)aniline (PubChem CID 79222849) has the molecular formula C14H13Br2NS and a molecular weight of 387.14 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-phenylsulfanylethyl)aniline.
| Compound Name | 2,5-dibromo-N-(2-phenylsulfanylethyl)aniline |
|---|---|
| PubChem CID | 79222849 |
| Molecular Formula | C14H13Br2NS |
| Molecular Weight | 387.14 g/mol |
| Exact Mass | 384.91 |
| IUPAC Name | 2,5-dibromo-N-(2-phenylsulfanylethyl)aniline |
| SMILES | Brc1ccc(Br)c(NCCSc2ccccc2)c1 |
| InChI | InChI=1S/C14H13Br2NS/c15-11-6-7-13(16)14(10-11)17-8-9-18-12-4-2-1-3-5-12/h1-7,10,17H,8-9H2 |
| InChIKey | MYOVCGSHLLJXHF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.14 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|