C14H17ClN2O2S2 — CID 142779207
2-(2-phenylsulfanylethylamino)benzenesulfonamide;hydrochloride (PubChem CID 142779207) has the molecular formula C14H17ClN2O2S2 and a molecular weight of 344.89 g/mol. Its IUPAC name is 2-(2-phenylsulfanylethylamino)benzenesulfonamide;hydrochloride.
| Compound Name | 2-(2-phenylsulfanylethylamino)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 142779207 |
| Molecular Formula | C14H17ClN2O2S2 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-(2-phenylsulfanylethylamino)benzenesulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)c1ccccc1NCCSc1ccccc1 |
| InChI | InChI=1S/C14H16N2O2S2.ClH/c15-20(17,18)14-9-5-4-8-13(14)16-10-11-19-12-6-2-1-3-7-12;/h1-9,16H,10-11H2,(H2,15,17,18);1H |
| InChIKey | GRXAAVGHBIWVMW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|