C16H15Br2NOS — CID 3694417
N-(2,4-dibromophenyl)-4-phenylsulfanylbutanamide (PubChem CID 3694417) has the molecular formula C16H15Br2NOS and a molecular weight of 429.18 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-4-phenylsulfanylbutanamide.
| Compound Name | N-(2,4-dibromophenyl)-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 3694417 |
| Molecular Formula | C16H15Br2NOS |
| Molecular Weight | 429.18 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | N-(2,4-dibromophenyl)-4-phenylsulfanylbutanamide |
| SMILES | O=C(CCCSc1ccccc1)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H15Br2NOS/c17-12-8-9-15(14(18)11-12)19-16(20)7-4-10-21-13-5-2-1-3-6-13/h1-3,5-6,8-9,11H,4,7,10H2,(H,19,20) |
| InChIKey | BNVUXRLFOQMUNX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.18 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|