C12H14Br2N2O3 — CID 43473555
4-[[2-(2,4-dibromoanilino)-2-oxoethyl]amino]butanoic acid (PubChem CID 43473555) has the molecular formula C12H14Br2N2O3 and a molecular weight of 394.06 g/mol. Its IUPAC name is 4-[[2-(2,4-dibromoanilino)-2-oxoethyl]amino]butanoic acid.
| Compound Name | 4-[[2-(2,4-dibromoanilino)-2-oxoethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43473555 |
| Molecular Formula | C12H14Br2N2O3 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | 4-[[2-(2,4-dibromoanilino)-2-oxoethyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNCC(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H14Br2N2O3/c13-8-3-4-10(9(14)6-8)16-11(17)7-15-5-1-2-12(18)19/h3-4,6,15H,1-2,5,7H2,(H,16,17)(H,18,19) |
| InChIKey | GCICXDZAJWEROZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|