5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid

C13H16BrNO3 — CID 82036907

IUPAC5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid
SMILESCc1cc(Br)c(NC(=O)CCCC(=O)O)cc1C
InChIInChI=1S/C13H16BrNO3/c1-8-6-10(14)11(7-9(8)2)15-12(16)4-3-5-13(17)18/h6-7H,3-5H2,1-2H3,(H,15,16)(H,17,18)
InChIKeyDRNZIABRFAFAJG-UHFFFAOYSA-N
MW314.18 g/mol
LogP3.26
Rot. Bonds5

About 5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid

5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid (PubChem CID 82036907) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is 5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid.

Molecular Properties

Compound Name5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid
PubChem CID82036907
Molecular FormulaC13H16BrNO3
Molecular Weight314.18 g/mol
Exact Mass313.03
IUPAC Name5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid
SMILESCc1cc(Br)c(NC(=O)CCCC(=O)O)cc1C
InChIInChI=1S/C13H16BrNO3/c1-8-6-10(14)11(7-9(8)2)15-12(16)4-3-5-13(17)18/h6-7H,3-5H2,1-2H3,(H,15,16)(H,17,18)
InChIKeyDRNZIABRFAFAJG-UHFFFAOYSA-N
XLogP3.26
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.18
LogP ≤ 53.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid?
The IUPAC name of 5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid (CID 82036907) is 5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid.
What is the SMILES notation for 5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid?
The canonical SMILES for 5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid is Cc1cc(Br)c(NC(=O)CCCC(=O)O)cc1C.
What is the InChIKey of 5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid?
The InChIKey is DRNZIABRFAFAJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO3/c1-8-6-10(14)11(7-9(8)2)15-12(16)4-3-5-13(17)18/h6-7H,3-5H2,1-2H3,(H,15,16)(H,17,18).
What are the key properties of 5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid?
5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid has a molecular weight of 314.18 g/mol, XLogP of 3.26, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromo-4,5-dimethylanilino)-5-oxopentanoic acid is sourced from PubChem (CID 82036907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).