C16H13Br2NO — CID 103412776
2,4-dibromo-5-methoxy-N-(3-phenylprop-2-ynyl)aniline (PubChem CID 103412776) has the molecular formula C16H13Br2NO and a molecular weight of 395.09 g/mol. Its IUPAC name is 2,4-dibromo-5-methoxy-N-(3-phenylprop-2-ynyl)aniline.
| Compound Name | 2,4-dibromo-5-methoxy-N-(3-phenylprop-2-ynyl)aniline |
|---|---|
| PubChem CID | 103412776 |
| Molecular Formula | C16H13Br2NO |
| Molecular Weight | 395.09 g/mol |
| Exact Mass | 392.94 |
| IUPAC Name | 2,4-dibromo-5-methoxy-N-(3-phenylprop-2-ynyl)aniline |
| SMILES | COc1cc(NCC#Cc2ccccc2)c(Br)cc1Br |
| InChI | InChI=1S/C16H13Br2NO/c1-20-16-11-15(13(17)10-14(16)18)19-9-5-8-12-6-3-2-4-7-12/h2-4,6-7,10-11,19H,9H2,1H3 |
| InChIKey | MEJMRGBAGZGOSO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.09 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|