C16H17Br2NO2 — CID 103412284
2,4-dibromo-5-methoxy-N-[[2-(methoxymethyl)phenyl]methyl]aniline (PubChem CID 103412284) has the molecular formula C16H17Br2NO2 and a molecular weight of 415.13 g/mol. Its IUPAC name is 2,4-dibromo-5-methoxy-N-[[2-(methoxymethyl)phenyl]methyl]aniline.
| Compound Name | 2,4-dibromo-5-methoxy-N-[[2-(methoxymethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 103412284 |
| Molecular Formula | C16H17Br2NO2 |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | 2,4-dibromo-5-methoxy-N-[[2-(methoxymethyl)phenyl]methyl]aniline |
| SMILES | COCc1ccccc1CNc1cc(OC)c(Br)cc1Br |
| InChI | InChI=1S/C16H17Br2NO2/c1-20-10-12-6-4-3-5-11(12)9-19-15-8-16(21-2)14(18)7-13(15)17/h3-8,19H,9-10H2,1-2H3 |
| InChIKey | LINBDHCGOOWHAP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |