C18H23NO4 — CID 78885346
2-(methoxymethyl)-N-[(2,4,5-trimethoxyphenyl)methyl]aniline (PubChem CID 78885346) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(methoxymethyl)-N-[(2,4,5-trimethoxyphenyl)methyl]aniline.
| Compound Name | 2-(methoxymethyl)-N-[(2,4,5-trimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 78885346 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-(methoxymethyl)-N-[(2,4,5-trimethoxyphenyl)methyl]aniline |
| SMILES | COCc1ccccc1NCc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C18H23NO4/c1-20-12-13-7-5-6-8-15(13)19-11-14-9-17(22-3)18(23-4)10-16(14)21-2/h5-10,19H,11-12H2,1-4H3 |
| InChIKey | QMHRWTMHAMHRSQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |