C14H11Br2Cl2NO — CID 103412160
2,4-dibromo-N-[(2,3-dichlorophenyl)methyl]-5-methoxyaniline (PubChem CID 103412160) has the molecular formula C14H11Br2Cl2NO and a molecular weight of 439.96 g/mol. Its IUPAC name is 2,4-dibromo-N-[(2,3-dichlorophenyl)methyl]-5-methoxyaniline.
| Compound Name | 2,4-dibromo-N-[(2,3-dichlorophenyl)methyl]-5-methoxyaniline |
|---|---|
| PubChem CID | 103412160 |
| Molecular Formula | C14H11Br2Cl2NO |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 436.86 |
| IUPAC Name | 2,4-dibromo-N-[(2,3-dichlorophenyl)methyl]-5-methoxyaniline |
| SMILES | COc1cc(NCc2cccc(Cl)c2Cl)c(Br)cc1Br |
| InChI | InChI=1S/C14H11Br2Cl2NO/c1-20-13-6-12(9(15)5-10(13)16)19-7-8-3-2-4-11(17)14(8)18/h2-6,19H,7H2,1H3 |
| InChIKey | LKTRORJLDAFFLB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |