C13H9BrCl3N — CID 81263519
2-bromo-5-chloro-N-[(2,3-dichlorophenyl)methyl]aniline (PubChem CID 81263519) has the molecular formula C13H9BrCl3N and a molecular weight of 365.49 g/mol. Its IUPAC name is 2-bromo-5-chloro-N-[(2,3-dichlorophenyl)methyl]aniline.
| Compound Name | 2-bromo-5-chloro-N-[(2,3-dichlorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 81263519 |
| Molecular Formula | C13H9BrCl3N |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 362.90 |
| IUPAC Name | 2-bromo-5-chloro-N-[(2,3-dichlorophenyl)methyl]aniline |
| SMILES | Clc1ccc(Br)c(NCc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C13H9BrCl3N/c14-10-5-4-9(15)6-12(10)18-7-8-2-1-3-11(16)13(8)17/h1-6,18H,7H2 |
| InChIKey | QGJHBICWXRBWOX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |