C13H10Br2ClN — CID 43432251
2,5-dibromo-N-[(2-chlorophenyl)methyl]aniline (PubChem CID 43432251) has the molecular formula C13H10Br2ClN and a molecular weight of 375.49 g/mol. Its IUPAC name is 2,5-dibromo-N-[(2-chlorophenyl)methyl]aniline.
| Compound Name | 2,5-dibromo-N-[(2-chlorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 43432251 |
| Molecular Formula | C13H10Br2ClN |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 372.89 |
| IUPAC Name | 2,5-dibromo-N-[(2-chlorophenyl)methyl]aniline |
| SMILES | Clc1ccccc1CNc1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H10Br2ClN/c14-10-5-6-11(15)13(7-10)17-8-9-3-1-2-4-12(9)16/h1-7,17H,8H2 |
| InChIKey | WPCXRWXUUXPJDQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |