C12H9Br2ClN2 — CID 12611962
3,5-dibromo-N-[(2-chlorophenyl)methyl]pyridin-2-amine (PubChem CID 12611962) has the molecular formula C12H9Br2ClN2 and a molecular weight of 376.48 g/mol. Its IUPAC name is 3,5-dibromo-N-[(2-chlorophenyl)methyl]pyridin-2-amine.
| Compound Name | 3,5-dibromo-N-[(2-chlorophenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 12611962 |
| Molecular Formula | C12H9Br2ClN2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 373.88 |
| IUPAC Name | 3,5-dibromo-N-[(2-chlorophenyl)methyl]pyridin-2-amine |
| SMILES | Clc1ccccc1CNc1ncc(Br)cc1Br |
| InChI | InChI=1S/C12H9Br2ClN2/c13-9-5-10(14)12(17-7-9)16-6-8-3-1-2-4-11(8)15/h1-5,7H,6H2,(H,16,17) |
| InChIKey | QTXIDGRNPXETCV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |