C13H12Br2N2O2 — CID 662389
2-[[(3,5-dibromo-2-pyridinyl)amino]methyl]-6-methoxyphenol (PubChem CID 662389) has the molecular formula C13H12Br2N2O2 and a molecular weight of 388.06 g/mol. Its IUPAC name is 2-[[(3,5-dibromo-2-pyridinyl)amino]methyl]-6-methoxyphenol.
| Compound Name | 2-[[(3,5-dibromo-2-pyridinyl)amino]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 662389 |
| Molecular Formula | C13H12Br2N2O2 |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | 2-[[(3,5-dibromo-2-pyridinyl)amino]methyl]-6-methoxyphenol |
| SMILES | COc1cccc(CNc2ncc(Br)cc2Br)c1O |
| InChI | InChI=1S/C13H12Br2N2O2/c1-19-11-4-2-3-8(12(11)18)6-16-13-10(15)5-9(14)7-17-13/h2-5,7,18H,6H2,1H3,(H,16,17) |
| InChIKey | KECAOEBSADERDC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|