C14H16BrN2O2+ — CID 6920874
2-[[(5-bromo-3-methylpyridin-1-ium-2-yl)amino]methyl]-6-methoxyphenol (PubChem CID 6920874) has the molecular formula C14H16BrN2O2+ and a molecular weight of 324.20 g/mol. Its IUPAC name is 2-[[(5-bromo-3-methylpyridin-1-ium-2-yl)amino]methyl]-6-methoxyphenol.
| Compound Name | 2-[[(5-bromo-3-methylpyridin-1-ium-2-yl)amino]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 6920874 |
| Molecular Formula | C14H16BrN2O2+ |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-[[(5-bromo-3-methylpyridin-1-ium-2-yl)amino]methyl]-6-methoxyphenol |
| SMILES | COc1cccc(CNc2[nH+]cc(Br)cc2C)c1O |
| InChI | InChI=1S/C14H15BrN2O2/c1-9-6-11(15)8-17-14(9)16-7-10-4-3-5-12(19-2)13(10)18/h3-6,8,18H,7H2,1-2H3,(H,16,17)/p+1 |
| InChIKey | RJTZOEADNWAFNJ-UHFFFAOYSA-O |
| XLogP | 2.90 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|