C13H15N2O2+ — CID 6950881
2-methoxy-6-[(pyridin-1-ium-2-ylamino)methyl]phenol (PubChem CID 6950881) has the molecular formula C13H15N2O2+ and a molecular weight of 231.28 g/mol. Its IUPAC name is 2-methoxy-6-[(pyridin-1-ium-2-ylamino)methyl]phenol.
| Compound Name | 2-methoxy-6-[(pyridin-1-ium-2-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 6950881 |
| Molecular Formula | C13H15N2O2+ |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 2-methoxy-6-[(pyridin-1-ium-2-ylamino)methyl]phenol |
| SMILES | COc1cccc(CNc2cccc[nH+]2)c1O |
| InChI | InChI=1S/C13H14N2O2/c1-17-11-6-4-5-10(13(11)16)9-15-12-7-2-3-8-14-12/h2-8,16H,9H2,1H3,(H,14,15)/p+1 |
| InChIKey | MBKLXMDLWISXIS-UHFFFAOYSA-O |
| XLogP | 1.83 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|