C16H14BrN3 — CID 79535450
3-bromo-2-N-(naphthalen-1-ylmethyl)pyridine-2,5-diamine (PubChem CID 79535450) has the molecular formula C16H14BrN3 and a molecular weight of 328.21 g/mol. Its IUPAC name is 3-bromo-2-N-(naphthalen-1-ylmethyl)pyridine-2,5-diamine.
| Compound Name | 3-bromo-2-N-(naphthalen-1-ylmethyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 79535450 |
| Molecular Formula | C16H14BrN3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 3-bromo-2-N-(naphthalen-1-ylmethyl)pyridine-2,5-diamine |
| SMILES | Nc1cnc(NCc2cccc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C16H14BrN3/c17-15-8-13(18)10-20-16(15)19-9-12-6-3-5-11-4-1-2-7-14(11)12/h1-8,10H,9,18H2,(H,19,20) |
| InChIKey | CBGFIXHCIMKMEI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |