C14H11Br2ClN2OS — CID 103414359
2-chloro-6-(2,4-dibromo-5-methoxyanilino)benzenecarbothioamide (PubChem CID 103414359) has the molecular formula C14H11Br2ClN2OS and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-chloro-6-(2,4-dibromo-5-methoxyanilino)benzenecarbothioamide.
| Compound Name | 2-chloro-6-(2,4-dibromo-5-methoxyanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 103414359 |
| Molecular Formula | C14H11Br2ClN2OS |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 447.86 |
| IUPAC Name | 2-chloro-6-(2,4-dibromo-5-methoxyanilino)benzenecarbothioamide |
| SMILES | COc1cc(Nc2cccc(Cl)c2C(N)=S)c(Br)cc1Br |
| InChI | InChI=1S/C14H11Br2ClN2OS/c1-20-12-6-11(7(15)5-8(12)16)19-10-4-2-3-9(17)13(10)14(18)21/h2-6,19H,1H3,(H2,18,21) |
| InChIKey | PQRJQZCOJUFQBE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|