C14H9Br2ClN2O — CID 103414163
2-chloro-6-(2,4-dibromo-5-methoxyanilino)benzonitrile (PubChem CID 103414163) has the molecular formula C14H9Br2ClN2O and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-chloro-6-(2,4-dibromo-5-methoxyanilino)benzonitrile.
| Compound Name | 2-chloro-6-(2,4-dibromo-5-methoxyanilino)benzonitrile |
|---|---|
| PubChem CID | 103414163 |
| Molecular Formula | C14H9Br2ClN2O |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 413.88 |
| IUPAC Name | 2-chloro-6-(2,4-dibromo-5-methoxyanilino)benzonitrile |
| SMILES | COc1cc(Nc2cccc(Cl)c2C#N)c(Br)cc1Br |
| InChI | InChI=1S/C14H9Br2ClN2O/c1-20-14-6-13(9(15)5-10(14)16)19-12-4-2-3-11(17)8(12)7-18/h2-6,19H,1H3 |
| InChIKey | YAUVEHIGEAINFS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |