C16H15Cl2N — CID 104726942
2,5-dichloro-4-methyl-N-[(E)-3-phenylprop-2-enyl]aniline (PubChem CID 104726942) has the molecular formula C16H15Cl2N and a molecular weight of 292.21 g/mol. Its IUPAC name is 2,5-dichloro-4-methyl-N-[(E)-3-phenylprop-2-enyl]aniline.
| Compound Name | 2,5-dichloro-4-methyl-N-[(E)-3-phenylprop-2-enyl]aniline |
|---|---|
| PubChem CID | 104726942 |
| Molecular Formula | C16H15Cl2N |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2,5-dichloro-4-methyl-N-[(E)-3-phenylprop-2-enyl]aniline |
| SMILES | Cc1cc(Cl)c(NC/C=C/c2ccccc2)cc1Cl |
| InChI | InChI=1S/C16H15Cl2N/c1-12-10-15(18)16(11-14(12)17)19-9-5-8-13-6-3-2-4-7-13/h2-8,10-11,19H,9H2,1H3/b8-5+ |
| InChIKey | CMYKOXTZQNUZFI-VMPITWQZSA-N |
| XLogP | 5.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |