C15H16N2 — CID 6508892
2-N-[(E)-3-phenylprop-2-enyl]benzene-1,2-diamine (PubChem CID 6508892) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-N-[(E)-3-phenylprop-2-enyl]benzene-1,2-diamine.
| Compound Name | 2-N-[(E)-3-phenylprop-2-enyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 6508892 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-N-[(E)-3-phenylprop-2-enyl]benzene-1,2-diamine |
| SMILES | Nc1ccccc1NC/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H16N2/c16-14-10-4-5-11-15(14)17-12-6-9-13-7-2-1-3-8-13/h1-11,17H,12,16H2/b9-6+ |
| InChIKey | UJTDSOLEQLKCHP-RMKNXTFCSA-N |
| XLogP | 3.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|