C16H13NO2 — CID 13017537
4-(3-phenylprop-2-ynylamino)benzoic acid (PubChem CID 13017537) has the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-(3-phenylprop-2-ynylamino)benzoic acid.
| Compound Name | 4-(3-phenylprop-2-ynylamino)benzoic acid |
|---|---|
| PubChem CID | 13017537 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 4-(3-phenylprop-2-ynylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NCC#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C16H13NO2/c18-16(19)14-8-10-15(11-9-14)17-12-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-11,17H,12H2,(H,18,19) |
| InChIKey | HNZFDFYOXORJJE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|