C13H12F3NO2 — CID 79788692
3,3,3-trifluoro-2-methyl-2-(3-phenylprop-2-ynylamino)propanoic acid (PubChem CID 79788692) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-(3-phenylprop-2-ynylamino)propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-(3-phenylprop-2-ynylamino)propanoic acid |
|---|---|
| PubChem CID | 79788692 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-(3-phenylprop-2-ynylamino)propanoic acid |
| SMILES | CC(NCC#Cc1ccccc1)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO2/c1-12(11(18)19,13(14,15)16)17-9-5-8-10-6-3-2-4-7-10/h2-4,6-7,17H,9H2,1H3,(H,18,19) |
| InChIKey | ROSBSNMKBFWBBE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|