C22H14 — CID 11644823
1,4-diethynyl-2,5-diphenylbenzene (PubChem CID 11644823) has the molecular formula C22H14 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1,4-diethynyl-2,5-diphenylbenzene.
| Compound Name | 1,4-diethynyl-2,5-diphenylbenzene |
|---|---|
| PubChem CID | 11644823 |
| Molecular Formula | C22H14 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1,4-diethynyl-2,5-diphenylbenzene |
| SMILES | C#Cc1cc(-c2ccccc2)c(C#C)cc1-c1ccccc1 |
| InChI | InChI=1S/C22H14/c1-3-17-15-22(20-13-9-6-10-14-20)18(4-2)16-21(17)19-11-7-5-8-12-19/h1-2,5-16H |
| InChIKey | XKAYHMNUSXBZIV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|