About benzene-1,2-dicarbonitrile;prop-2-enenitrile
benzene-1,2-dicarbonitrile;prop-2-enenitrile (PubChem CID 175057961) has the molecular formula C11H7N3
and a molecular weight of 181.20 g/mol. Its IUPAC name is benzene-1,2-dicarbonitrile;prop-2-enenitrile.
Molecular Properties
| Compound Name | benzene-1,2-dicarbonitrile;prop-2-enenitrile |
| PubChem CID | 175057961 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | benzene-1,2-dicarbonitrile;prop-2-enenitrile |
| SMILES | C=CC#N.N#Cc1ccccc1C#N |
| InChI | InChI=1S/C8H4N2.C3H3N/c9-5-7-3-1-2-4-8(7)6-10;1-2-3-4/h1-4H;2H,1H2 |
| InChIKey | AQDZDGJKEDRAAP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-dicarbonitrile;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-dicarbonitrile;prop-2-enenitrile?
The IUPAC name of benzene-1,2-dicarbonitrile;prop-2-enenitrile (CID 175057961) is benzene-1,2-dicarbonitrile;prop-2-enenitrile.
What is the SMILES notation for benzene-1,2-dicarbonitrile;prop-2-enenitrile?
The canonical SMILES for benzene-1,2-dicarbonitrile;prop-2-enenitrile is C=CC#N.N#Cc1ccccc1C#N.
What is the InChIKey of benzene-1,2-dicarbonitrile;prop-2-enenitrile?
The InChIKey is AQDZDGJKEDRAAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2.C3H3N/c9-5-7-3-1-2-4-8(7)6-10;1-2-3-4/h1-4H;2H,1H2.
What are the key properties of benzene-1,2-dicarbonitrile;prop-2-enenitrile?
benzene-1,2-dicarbonitrile;prop-2-enenitrile has a molecular weight of 181.20 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-dicarbonitrile;prop-2-enenitrile is sourced from PubChem (CID 175057961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).