About azane;benzene-1,2-dicarbonitrile
azane;benzene-1,2-dicarbonitrile (PubChem CID 141338892) has the molecular formula C8H7N3
and a molecular weight of 145.16 g/mol. Its IUPAC name is azane;benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | azane;benzene-1,2-dicarbonitrile |
| PubChem CID | 141338892 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | azane;benzene-1,2-dicarbonitrile |
| SMILES | N.N#Cc1ccccc1C#N |
| InChI | InChI=1S/C8H4N2.H3N/c9-5-7-3-1-2-4-8(7)6-10;/h1-4H;1H3 |
| InChIKey | AJOHUAGTNHMHDV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;benzene-1,2-dicarbonitrile?
The IUPAC name of azane;benzene-1,2-dicarbonitrile (CID 141338892) is azane;benzene-1,2-dicarbonitrile.
What is the SMILES notation for azane;benzene-1,2-dicarbonitrile?
The canonical SMILES for azane;benzene-1,2-dicarbonitrile is N.N#Cc1ccccc1C#N.
What is the InChIKey of azane;benzene-1,2-dicarbonitrile?
The InChIKey is AJOHUAGTNHMHDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2.H3N/c9-5-7-3-1-2-4-8(7)6-10;/h1-4H;1H3.
What are the key properties of azane;benzene-1,2-dicarbonitrile?
azane;benzene-1,2-dicarbonitrile has a molecular weight of 145.16 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;benzene-1,2-dicarbonitrile is sourced from PubChem (CID 141338892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).