About (2-cyanophenyl)azanium
(2-cyanophenyl)azanium (PubChem CID 144921904) has the molecular formula C7H7N2+
and a molecular weight of 119.15 g/mol. Its IUPAC name is (2-cyanophenyl)azanium.
Molecular Properties
| Compound Name | (2-cyanophenyl)azanium |
| PubChem CID | 144921904 |
| Molecular Formula | C7H7N2+ |
| Molecular Weight | 119.15 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | (2-cyanophenyl)azanium |
| SMILES | N#Cc1ccccc1[NH3+] |
| InChI | InChI=1S/C7H6N2/c8-5-6-3-1-2-4-7(6)9/h1-4H,9H2/p+1 |
| InChIKey | HLCPWBZNUKCSBN-UHFFFAOYSA-O |
| XLogP | 0.43 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.15 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-cyanophenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyanophenyl)azanium?
The IUPAC name of (2-cyanophenyl)azanium (CID 144921904) is (2-cyanophenyl)azanium.
What is the SMILES notation for (2-cyanophenyl)azanium?
The canonical SMILES for (2-cyanophenyl)azanium is N#Cc1ccccc1[NH3+].
What is the InChIKey of (2-cyanophenyl)azanium?
The InChIKey is HLCPWBZNUKCSBN-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H6N2/c8-5-6-3-1-2-4-7(6)9/h1-4H,9H2/p+1.
What are the key properties of (2-cyanophenyl)azanium?
(2-cyanophenyl)azanium has a molecular weight of 119.15 g/mol, XLogP of 0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl)azanium is sourced from PubChem (CID 144921904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).