About 2-aminobenzonitrile;methane
2-aminobenzonitrile;methane (PubChem CID 175308873) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-aminobenzonitrile;methane.
Molecular Properties
| Compound Name | 2-aminobenzonitrile;methane |
| PubChem CID | 175308873 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 2-aminobenzonitrile;methane |
| SMILES | C.N#Cc1ccccc1N |
| InChI | InChI=1S/C7H6N2.CH4/c8-5-6-3-1-2-4-7(6)9;/h1-4H,9H2;1H4 |
| InChIKey | NAJGPXCHCLFQGO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzonitrile;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzonitrile;methane?
The IUPAC name of 2-aminobenzonitrile;methane (CID 175308873) is 2-aminobenzonitrile;methane.
What is the SMILES notation for 2-aminobenzonitrile;methane?
The canonical SMILES for 2-aminobenzonitrile;methane is C.N#Cc1ccccc1N.
What is the InChIKey of 2-aminobenzonitrile;methane?
The InChIKey is NAJGPXCHCLFQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.CH4/c8-5-6-3-1-2-4-7(6)9;/h1-4H,9H2;1H4.
What are the key properties of 2-aminobenzonitrile;methane?
2-aminobenzonitrile;methane has a molecular weight of 134.18 g/mol, XLogP of 1.78, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzonitrile;methane is sourced from PubChem (CID 175308873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).